C20H29Cl2N5 — CID 89216985
1-[(Z)-3-amino-3-(3,4-dichlorophenyl)prop-2-enimidoyl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine (PubChem CID 89216985) has the molecular formula C20H29Cl2N5 and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-[(Z)-3-amino-3-(3,4-dichlorophenyl)prop-2-enimidoyl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine.
| Compound Name | 1-[(Z)-3-amino-3-(3,4-dichlorophenyl)prop-2-enimidoyl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 89216985 |
| Molecular Formula | C20H29Cl2N5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 1-[(Z)-3-amino-3-(3,4-dichlorophenyl)prop-2-enimidoyl]-N-(2-pyrrolidin-1-ylethyl)piperidin-4-amine |
| SMILES | [H]/N=C(/C=C(\N)c1ccc(Cl)c(Cl)c1)N1CCC(NCCN2CCCC2)CC1 |
| InChI | InChI=1S/C20H29Cl2N5/c21-17-4-3-15(13-18(17)22)19(23)14-20(24)27-10-5-16(6-11-27)25-7-12-26-8-1-2-9-26/h3-4,13-14,16,24-25H,1-2,5-12,23H2/b19-14-,24-20- |
| InChIKey | IVGPNASKLFAYTM-RIRUJVASSA-N |
| XLogP | 3.42 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|