C26H19Cl2N3O3 — CID 59446728
2-[3-(3,4-dichlorophenyl)-3-hydroxy-3-[4-(1H-pyrazol-4-yl)phenyl]propyl]isoindole-1,3-dione (PubChem CID 59446728) has the molecular formula C26H19Cl2N3O3 and a molecular weight of 492.36 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenyl)-3-hydroxy-3-[4-(1H-pyrazol-4-yl)phenyl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3,4-dichlorophenyl)-3-hydroxy-3-[4-(1H-pyrazol-4-yl)phenyl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59446728 |
| Molecular Formula | C26H19Cl2N3O3 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 2-[3-(3,4-dichlorophenyl)-3-hydroxy-3-[4-(1H-pyrazol-4-yl)phenyl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC(O)(c1ccc(-c2cn[nH]c2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H19Cl2N3O3/c27-22-10-9-19(13-23(22)28)26(34,18-7-5-16(6-8-18)17-14-29-30-15-17)11-12-31-24(32)20-3-1-2-4-21(20)25(31)33/h1-10,13-15,34H,11-12H2,(H,29,30) |
| InChIKey | CITZNEIYSATCEW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|