C25H34O4 — CID 59449195
bis(2-bicyclo[2.2.1]heptanylmethyl) (2R,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate (PubChem CID 59449195) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is bis(2-bicyclo[2.2.1]heptanylmethyl) (2R,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate.
| Compound Name | bis(2-bicyclo[2.2.1]heptanylmethyl) (2R,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 59449195 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | bis(2-bicyclo[2.2.1]heptanylmethyl) (2R,3S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylate |
| SMILES | O=C(OCC1CC2CCC1C2)[C@@H]1C2C=CC(C2)[C@@H]1C(=O)OCC1CC2CCC1C2 |
| InChI | InChI=1S/C25H34O4/c26-24(28-12-20-9-14-1-3-16(20)7-14)22-18-5-6-19(11-18)23(22)25(27)29-13-21-10-15-2-4-17(21)8-15/h5-6,14-23H,1-4,7-13H2/t14?,15?,16?,17?,18?,19?,20?,21?,22-,23+ |
| InChIKey | FFIMJEFGVFYEBL-AYVXSLDASA-N |
| XLogP | 4.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|