About 3-propylsulfanylpropane-1,1-dithiol
3-propylsulfanylpropane-1,1-dithiol (PubChem CID 59449399) has the molecular formula C6H14S3
and a molecular weight of 182.38 g/mol. Its IUPAC name is 3-propylsulfanylpropane-1,1-dithiol.
Molecular Properties
| Compound Name | 3-propylsulfanylpropane-1,1-dithiol |
| PubChem CID | 59449399 |
| Molecular Formula | C6H14S3 |
| Molecular Weight | 182.38 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 3-propylsulfanylpropane-1,1-dithiol |
| SMILES | CCCSCCC(S)S |
| InChI | InChI=1S/C6H14S3/c1-2-4-9-5-3-6(7)8/h6-8H,2-5H2,1H3 |
| InChIKey | IKTXSGRKKHJWIV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-propylsulfanylpropane-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propylsulfanylpropane-1,1-dithiol?
The IUPAC name of 3-propylsulfanylpropane-1,1-dithiol (CID 59449399) is 3-propylsulfanylpropane-1,1-dithiol.
What is the SMILES notation for 3-propylsulfanylpropane-1,1-dithiol?
The canonical SMILES for 3-propylsulfanylpropane-1,1-dithiol is CCCSCCC(S)S.
What is the InChIKey of 3-propylsulfanylpropane-1,1-dithiol?
The InChIKey is IKTXSGRKKHJWIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S3/c1-2-4-9-5-3-6(7)8/h6-8H,2-5H2,1H3.
What are the key properties of 3-propylsulfanylpropane-1,1-dithiol?
3-propylsulfanylpropane-1,1-dithiol has a molecular weight of 182.38 g/mol, XLogP of 2.71, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propylsulfanylpropane-1,1-dithiol is sourced from PubChem (CID 59449399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).