C40H37F6N2O2Pt- — CID 59449557
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum (PubChem CID 59449557) has the molecular formula C40H37F6N2O2Pt- and a molecular weight of 886.81 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum |
|---|---|
| PubChem CID | 59449557 |
| Molecular Formula | C40H37F6N2O2Pt- |
| Molecular Weight | 886.81 g/mol |
| Exact Mass | 886.24 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum |
| SMILES | CC(C)(C)C(O)CC(O)CCc1ccc(-n2c3ccccc3c3ccccc32)cc1.FC(F)(F)c1[c-]c(-c2ccccn2)cc(C(F)(F)F)c1.[Pt] |
| InChI | InChI=1S/C27H31NO2.C13H6F6N.Pt/c1-27(2,3)26(30)18-21(29)17-14-19-12-15-20(16-13-19)28-24-10-6-4-8-22(24)23-9-5-7-11-25(23)28;14-12(15,16)9-5-8(11-3-1-2-4-20-11)6-10(7-9)13(17,18)19;/h4-13,15-16,21,26,29-30H,14,17-18H2,1-3H3;1-5,7H;/q;-1; |
| InChIKey | UDKBSFKEGFHYST-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.81 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|