C39H38F3N2O2Pt- — CID 59449589
1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine (PubChem CID 59449589) has the molecular formula C39H38F3N2O2Pt- and a molecular weight of 818.82 g/mol. Its IUPAC name is 1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
| Compound Name | 1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 59449589 |
| Molecular Formula | C39H38F3N2O2Pt- |
| Molecular Weight | 818.82 g/mol |
| Exact Mass | 818.25 |
| IUPAC Name | 1-(4-carbazol-9-ylphenyl)-6,6-dimethylheptane-3,5-diol;platinum;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| SMILES | CC(C)(C)C(O)CC(O)CCc1ccc(-n2c3ccccc3c3ccccc32)cc1.FC(F)(F)c1c[c-]c(-c2ccccn2)cc1.[Pt] |
| InChI | InChI=1S/C27H31NO2.C12H7F3N.Pt/c1-27(2,3)26(30)18-21(29)17-14-19-12-15-20(16-13-19)28-24-10-6-4-8-22(24)23-9-5-7-11-25(23)28;13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11;/h4-13,15-16,21,26,29-30H,14,17-18H2,1-3H3;1-4,6-8H;/q;-1; |
| InChIKey | BCUROGDOONXBBT-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.82 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|