C16H25F3N4O — CID 59454325
3-N-methyl-1-N-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)benzene-1,3-diamine (PubChem CID 59454325) has the molecular formula C16H25F3N4O and a molecular weight of 346.40 g/mol. Its IUPAC name is 3-N-methyl-1-N-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)benzene-1,3-diamine.
| Compound Name | 3-N-methyl-1-N-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)benzene-1,3-diamine |
|---|---|
| PubChem CID | 59454325 |
| Molecular Formula | C16H25F3N4O |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-N-methyl-1-N-[3-(4-methylpiperazin-1-yl)propyl]-4-(trifluoromethoxy)benzene-1,3-diamine |
| SMILES | CNc1cc(NCCCN2CCN(C)CC2)ccc1OC(F)(F)F |
| InChI | InChI=1S/C16H25F3N4O/c1-20-14-12-13(4-5-15(14)24-16(17,18)19)21-6-3-7-23-10-8-22(2)9-11-23/h4-5,12,20-21H,3,6-11H2,1-2H3 |
| InChIKey | VATUOPXREILCIV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|