C12H23N3O2 — CID 59464026
N-[N-acetyl-N'-(4,4-dimethylpentyl)carbamimidoyl]acetamide (PubChem CID 59464026) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is N-[N-acetyl-N'-(4,4-dimethylpentyl)carbamimidoyl]acetamide.
| Compound Name | N-[N-acetyl-N'-(4,4-dimethylpentyl)carbamimidoyl]acetamide |
|---|---|
| PubChem CID | 59464026 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-[N-acetyl-N'-(4,4-dimethylpentyl)carbamimidoyl]acetamide |
| SMILES | CC(=O)NC(=NCCCC(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C12H23N3O2/c1-9(16)14-11(15-10(2)17)13-8-6-7-12(3,4)5/h6-8H2,1-5H3,(H2,13,14,15,16,17) |
| InChIKey | GSFYEHWULCFZGY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|