C25H30N2O6 — CID 59467294
(E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-(ethylamino)phenoxy]propoxy]-4-(ethylamino)phenyl]prop-2-enoic acid (PubChem CID 59467294) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is (E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-(ethylamino)phenoxy]propoxy]-4-(ethylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-(ethylamino)phenoxy]propoxy]-4-(ethylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59467294 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (E)-3-[3-[3-[5-[(E)-2-carboxyethenyl]-2-(ethylamino)phenoxy]propoxy]-4-(ethylamino)phenyl]prop-2-enoic acid |
| SMILES | CCNc1ccc(/C=C/C(=O)O)cc1OCCCOc1cc(/C=C/C(=O)O)ccc1NCC |
| InChI | InChI=1S/C25H30N2O6/c1-3-26-20-10-6-18(8-12-24(28)29)16-22(20)32-14-5-15-33-23-17-19(9-13-25(30)31)7-11-21(23)27-4-2/h6-13,16-17,26-27H,3-5,14-15H2,1-2H3,(H,28,29)(H,30,31)/b12-8+,13-9+ |
| InChIKey | OWOSVFHBSXYCTL-QHKWOANTSA-N |
| XLogP | 4.59 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|