C21H22BrN5O3S — CID 59468398
[3-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]phenyl]-[4-(2-hydroperoxyethyl)piperazin-1-yl]methanone (PubChem CID 59468398) has the molecular formula C21H22BrN5O3S and a molecular weight of 504.41 g/mol. Its IUPAC name is [3-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]phenyl]-[4-(2-hydroperoxyethyl)piperazin-1-yl]methanone.
| Compound Name | [3-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]phenyl]-[4-(2-hydroperoxyethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 59468398 |
| Molecular Formula | C21H22BrN5O3S |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | [3-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]phenyl]-[4-(2-hydroperoxyethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(Nc2nccc(-c3ccc(Br)s3)n2)c1)N1CCN(CCOO)CC1 |
| InChI | InChI=1S/C21H22BrN5O3S/c22-19-5-4-18(31-19)17-6-7-23-21(25-17)24-16-3-1-2-15(14-16)20(28)27-10-8-26(9-11-27)12-13-30-29/h1-7,14,29H,8-13H2,(H,23,24,25) |
| InChIKey | GJOVRSCLDLUXCF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|