C19H17BrN4O3S — CID 59468484
[5-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]-2-hydroxyphenyl]-morpholin-4-ylmethanone (PubChem CID 59468484) has the molecular formula C19H17BrN4O3S and a molecular weight of 461.34 g/mol. Its IUPAC name is [5-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]-2-hydroxyphenyl]-morpholin-4-ylmethanone.
| Compound Name | [5-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]-2-hydroxyphenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 59468484 |
| Molecular Formula | C19H17BrN4O3S |
| Molecular Weight | 461.34 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | [5-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]-2-hydroxyphenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(Nc2nccc(-c3ccc(Br)s3)n2)ccc1O)N1CCOCC1 |
| InChI | InChI=1S/C19H17BrN4O3S/c20-17-4-3-16(28-17)14-5-6-21-19(23-14)22-12-1-2-15(25)13(11-12)18(26)24-7-9-27-10-8-24/h1-6,11,25H,7-10H2,(H,21,22,23) |
| InChIKey | HQPKSJOPZQFTQV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|