C17H16BrN5OS — CID 59468534
N-(2-aminoethyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide (PubChem CID 59468534) has the molecular formula C17H16BrN5OS and a molecular weight of 418.32 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-(2-aminoethyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 59468534 |
| Molecular Formula | C17H16BrN5OS |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | N-(2-aminoethyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide |
| SMILES | NCCNC(=O)c1ccc(Nc2nccc(-c3ccc(Br)s3)n2)cc1 |
| InChI | InChI=1S/C17H16BrN5OS/c18-15-6-5-14(25-15)13-7-9-21-17(23-13)22-12-3-1-11(2-4-12)16(24)20-10-8-19/h1-7,9H,8,10,19H2,(H,20,24)(H,21,22,23) |
| InChIKey | ZMUQYTRIPKPJKC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |