C19H20BrN5OS — CID 59468393
N-(4-aminobutyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide (PubChem CID 59468393) has the molecular formula C19H20BrN5OS and a molecular weight of 446.37 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | N-(4-aminobutyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 59468393 |
| Molecular Formula | C19H20BrN5OS |
| Molecular Weight | 446.37 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N-(4-aminobutyl)-4-[[4-(5-bromothiophen-2-yl)pyrimidin-2-yl]amino]benzamide |
| SMILES | NCCCCNC(=O)c1ccc(Nc2nccc(-c3ccc(Br)s3)n2)cc1 |
| InChI | InChI=1S/C19H20BrN5OS/c20-17-8-7-16(27-17)15-9-12-23-19(25-15)24-14-5-3-13(4-6-14)18(26)22-11-2-1-10-21/h3-9,12H,1-2,10-11,21H2,(H,22,26)(H,23,24,25) |
| InChIKey | BPFVHCCBQJHBRZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|