C20H18O7S2 — CID 59469307
4-[2-methoxy-5-methyl-3-(4-sulfophenyl)phenyl]benzenesulfonic acid (PubChem CID 59469307) has the molecular formula C20H18O7S2 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-[2-methoxy-5-methyl-3-(4-sulfophenyl)phenyl]benzenesulfonic acid.
| Compound Name | 4-[2-methoxy-5-methyl-3-(4-sulfophenyl)phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59469307 |
| Molecular Formula | C20H18O7S2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 4-[2-methoxy-5-methyl-3-(4-sulfophenyl)phenyl]benzenesulfonic acid |
| SMILES | COc1c(-c2ccc(S(=O)(=O)O)cc2)cc(C)cc1-c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H18O7S2/c1-13-11-18(14-3-7-16(8-4-14)28(21,22)23)20(27-2)19(12-13)15-5-9-17(10-6-15)29(24,25)26/h3-12H,1-2H3,(H,21,22,23)(H,24,25,26) |
| InChIKey | SGSKQSMAAZHUTL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|