C17H12F8N2O5 — CID 59469684
N-[4-(hydroperoxyamino)-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanamide (PubChem CID 59469684) has the molecular formula C17H12F8N2O5 and a molecular weight of 476.28 g/mol. Its IUPAC name is N-[4-(hydroperoxyamino)-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanamide.
| Compound Name | N-[4-(hydroperoxyamino)-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanamide |
|---|---|
| PubChem CID | 59469684 |
| Molecular Formula | C17H12F8N2O5 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-[4-(hydroperoxyamino)-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-(2,3,4,5,6-pentafluorophenoxy)propanamide |
| SMILES | CC(O)(COc1c(F)c(F)c(F)c(F)c1F)C(=O)Nc1ccc(NOO)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F8N2O5/c1-16(29,5-31-14-12(21)10(19)9(18)11(20)13(14)22)15(28)26-6-2-3-8(27-32-30)7(4-6)17(23,24)25/h2-4,27,29-30H,5H2,1H3,(H,26,28) |
| InChIKey | MUBNKIRUEYDDCY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|