C11H23NY-2 — CID 59474981
(2R,3R)-3-methanidyl-N,4-dimethyl-N-propan-2-ylpentan-2-amine;yttrium (PubChem CID 59474981) has the molecular formula C11H23NY-2 and a molecular weight of 258.22 g/mol. Its IUPAC name is (2R,3R)-3-methanidyl-N,4-dimethyl-N-propan-2-ylpentan-2-amine;yttrium.
| Compound Name | (2R,3R)-3-methanidyl-N,4-dimethyl-N-propan-2-ylpentan-2-amine;yttrium |
|---|---|
| PubChem CID | 59474981 |
| Molecular Formula | C11H23NY-2 |
| Molecular Weight | 258.22 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (2R,3R)-3-methanidyl-N,4-dimethyl-N-propan-2-ylpentan-2-amine;yttrium |
| SMILES | [CH2-][C@H](C(C)C)[C@@H]([CH2-])N(C)C(C)C.[Y] |
| InChI | InChI=1S/C11H23N.Y/c1-8(2)10(5)11(6)12(7)9(3)4;/h8-11H,5-6H2,1-4,7H3;/q-2;/t10-,11-;/m1./s1 |
| InChIKey | LBCRUKILWBTDEP-NDXYWBNTSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|