C10H21NY-2 — CID 59474967
(2R,3R)-3-methanidyl-4-methyl-N-propan-2-ylpentan-2-amine;yttrium (PubChem CID 59474967) has the molecular formula C10H21NY-2 and a molecular weight of 244.19 g/mol. Its IUPAC name is (2R,3R)-3-methanidyl-4-methyl-N-propan-2-ylpentan-2-amine;yttrium.
| Compound Name | (2R,3R)-3-methanidyl-4-methyl-N-propan-2-ylpentan-2-amine;yttrium |
|---|---|
| PubChem CID | 59474967 |
| Molecular Formula | C10H21NY-2 |
| Molecular Weight | 244.19 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2R,3R)-3-methanidyl-4-methyl-N-propan-2-ylpentan-2-amine;yttrium |
| SMILES | [CH2-][C@H](C(C)C)[C@@H]([CH2-])NC(C)C.[Y] |
| InChI | InChI=1S/C10H21N.Y/c1-7(2)9(5)10(6)11-8(3)4;/h7-11H,5-6H2,1-4H3;/q-2;/t9-,10-;/m1./s1 |
| InChIKey | OWSSXKUKBGNSSF-DHTOPLTISA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|