C24H27ClFN5O3 — CID 59475705
tert-butyl N-[3-[5-[4-[3-chloro-5-(hydroxymethyl)anilino]-1,3,5-triazin-2-yl]-2-fluorophenyl]propyl]carbamate (PubChem CID 59475705) has the molecular formula C24H27ClFN5O3 and a molecular weight of 487.96 g/mol. Its IUPAC name is tert-butyl N-[3-[5-[4-[3-chloro-5-(hydroxymethyl)anilino]-1,3,5-triazin-2-yl]-2-fluorophenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[5-[4-[3-chloro-5-(hydroxymethyl)anilino]-1,3,5-triazin-2-yl]-2-fluorophenyl]propyl]carbamate |
|---|---|
| PubChem CID | 59475705 |
| Molecular Formula | C24H27ClFN5O3 |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | tert-butyl N-[3-[5-[4-[3-chloro-5-(hydroxymethyl)anilino]-1,3,5-triazin-2-yl]-2-fluorophenyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCc1cc(-c2ncnc(Nc3cc(Cl)cc(CO)c3)n2)ccc1F |
| InChI | InChI=1S/C24H27ClFN5O3/c1-24(2,3)34-23(33)27-8-4-5-16-11-17(6-7-20(16)26)21-28-14-29-22(31-21)30-19-10-15(13-32)9-18(25)12-19/h6-7,9-12,14,32H,4-5,8,13H2,1-3H3,(H,27,33)(H,28,29,30,31) |
| InChIKey | GMIYSGKZPCUEGG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|