C13H17F2NO3 — CID 59479138
tert-butyl 2-[4-(aminooxymethyl)phenyl]-2,2-difluoroacetate (PubChem CID 59479138) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is tert-butyl 2-[4-(aminooxymethyl)phenyl]-2,2-difluoroacetate.
| Compound Name | tert-butyl 2-[4-(aminooxymethyl)phenyl]-2,2-difluoroacetate |
|---|---|
| PubChem CID | 59479138 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | tert-butyl 2-[4-(aminooxymethyl)phenyl]-2,2-difluoroacetate |
| SMILES | CC(C)(C)OC(=O)C(F)(F)c1ccc(CON)cc1 |
| InChI | InChI=1S/C13H17F2NO3/c1-12(2,3)19-11(17)13(14,15)10-6-4-9(5-7-10)8-18-16/h4-7H,8,16H2,1-3H3 |
| InChIKey | LASQMZOHRFOLHX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|