C18H23ClN2OS — CID 59485212
2-(4-chloro-N-ethylanilino)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one (PubChem CID 59485212) has the molecular formula C18H23ClN2OS and a molecular weight of 350.92 g/mol. Its IUPAC name is 2-(4-chloro-N-ethylanilino)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one.
| Compound Name | 2-(4-chloro-N-ethylanilino)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one |
|---|---|
| PubChem CID | 59485212 |
| Molecular Formula | C18H23ClN2OS |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-(4-chloro-N-ethylanilino)-4a,5,6,7,8,9,10,10a-octahydrocycloocta[e][1,3]thiazin-4-one |
| SMILES | CCN(C1=NC(=O)C2CCCCCCC2S1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN2OS/c1-2-21(14-11-9-13(19)10-12-14)18-20-17(22)15-7-5-3-4-6-8-16(15)23-18/h9-12,15-16H,2-8H2,1H3 |
| InChIKey | VLUUROQIYFPXAQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |