About 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one
2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one (PubChem CID 59485297) has the molecular formula C15H18N2OS
and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one.
Molecular Properties
| Compound Name | 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one |
| PubChem CID | 59485297 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one |
| SMILES | CC1CCCC(C)N1c1nc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C15H18N2OS/c1-10-6-5-7-11(2)17(10)15-16-14(18)12-8-3-4-9-13(12)19-15/h3-4,8-11H,5-7H2,1-2H3 |
| InChIKey | WRLZUFHVWOARKX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one?
The IUPAC name of 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one (CID 59485297) is 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one.
What is the SMILES notation for 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one?
The canonical SMILES for 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one is CC1CCCC(C)N1c1nc(=O)c2ccccc2s1.
What is the InChIKey of 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one?
The InChIKey is WRLZUFHVWOARKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2OS/c1-10-6-5-7-11(2)17(10)15-16-14(18)12-8-3-4-9-13(12)19-15/h3-4,8-11H,5-7H2,1-2H3.
What are the key properties of 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one?
2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one has a molecular weight of 274.39 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-dimethylpiperidin-1-yl)-1,3-benzothiazin-4-one is sourced from PubChem (CID 59485297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).