C22H31F3N2O3 — CID 59487132
tert-butyl N-[4-[3-(oxan-4-ylamino)cyclopentyl]-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 59487132) has the molecular formula C22H31F3N2O3 and a molecular weight of 428.50 g/mol. Its IUPAC name is tert-butyl N-[4-[3-(oxan-4-ylamino)cyclopentyl]-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[3-(oxan-4-ylamino)cyclopentyl]-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 59487132 |
| Molecular Formula | C22H31F3N2O3 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | tert-butyl N-[4-[3-(oxan-4-ylamino)cyclopentyl]-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C2CCC(NC3CCOCC3)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H31F3N2O3/c1-21(2,3)30-20(28)27-17-6-7-18(19(13-17)22(23,24)25)14-4-5-16(12-14)26-15-8-10-29-11-9-15/h6-7,13-16,26H,4-5,8-12H2,1-3H3,(H,27,28) |
| InChIKey | ATIBBPQPYXZYQH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |