C24H26O3S — CID 59495191
5-[4-(3-methylsulfonylphenyl)phenyl]-1-phenylpentan-1-ol (PubChem CID 59495191) has the molecular formula C24H26O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is 5-[4-(3-methylsulfonylphenyl)phenyl]-1-phenylpentan-1-ol.
| Compound Name | 5-[4-(3-methylsulfonylphenyl)phenyl]-1-phenylpentan-1-ol |
|---|---|
| PubChem CID | 59495191 |
| Molecular Formula | C24H26O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 5-[4-(3-methylsulfonylphenyl)phenyl]-1-phenylpentan-1-ol |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(CCCCC(O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H26O3S/c1-28(26,27)23-12-7-11-22(18-23)20-16-14-19(15-17-20)8-5-6-13-24(25)21-9-3-2-4-10-21/h2-4,7,9-12,14-18,24-25H,5-6,8,13H2,1H3 |
| InChIKey | XKLXCINKGAJYKB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|