C30H29NO5 — CID 59497958
3-hexanoyl-1-[2-oxo-3-(4-phenylphenoxy)propyl]indole-5-carboxylic acid (PubChem CID 59497958) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is 3-hexanoyl-1-[2-oxo-3-(4-phenylphenoxy)propyl]indole-5-carboxylic acid.
| Compound Name | 3-hexanoyl-1-[2-oxo-3-(4-phenylphenoxy)propyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 59497958 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 3-hexanoyl-1-[2-oxo-3-(4-phenylphenoxy)propyl]indole-5-carboxylic acid |
| SMILES | CCCCCC(=O)c1cn(CC(=O)COc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C30H29NO5/c1-2-3-5-10-29(33)27-19-31(28-16-13-23(30(34)35)17-26(27)28)18-24(32)20-36-25-14-11-22(12-15-25)21-8-6-4-7-9-21/h4,6-9,11-17,19H,2-3,5,10,18,20H2,1H3,(H,34,35) |
| InChIKey | FINRGZRYMZWKTI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|