C34H43NO7 — CID 67541988
3-(6-methoxy-6-oxohexanoyl)-2-methyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-5-carboxylic acid (PubChem CID 67541988) has the molecular formula C34H43NO7 and a molecular weight of 577.72 g/mol. Its IUPAC name is 3-(6-methoxy-6-oxohexanoyl)-2-methyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-5-carboxylic acid.
| Compound Name | 3-(6-methoxy-6-oxohexanoyl)-2-methyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 67541988 |
| Molecular Formula | C34H43NO7 |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | 3-(6-methoxy-6-oxohexanoyl)-2-methyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-5-carboxylic acid |
| SMILES | CCCCCCCCc1ccc(OCC(=O)Cn2c(C)c(C(=O)CCCCC(=O)OC)c3cc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C34H43NO7/c1-4-5-6-7-8-9-12-25-15-18-28(19-16-25)42-23-27(36)22-35-24(2)33(31(37)13-10-11-14-32(38)41-3)29-21-26(34(39)40)17-20-30(29)35/h15-21H,4-14,22-23H2,1-3H3,(H,39,40) |
| InChIKey | MIXCWUIMYCBUGW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|