C33H43N3O5 — CID 67541870
2-tert-butyl-1-[2-hydroxy-3-(4-octylphenoxy)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)indole-5-carboxylic acid (PubChem CID 67541870) has the molecular formula C33H43N3O5 and a molecular weight of 561.72 g/mol. Its IUPAC name is 2-tert-butyl-1-[2-hydroxy-3-(4-octylphenoxy)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)indole-5-carboxylic acid.
| Compound Name | 2-tert-butyl-1-[2-hydroxy-3-(4-octylphenoxy)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)indole-5-carboxylic acid |
|---|---|
| PubChem CID | 67541870 |
| Molecular Formula | C33H43N3O5 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | 2-tert-butyl-1-[2-hydroxy-3-(4-octylphenoxy)propyl]-3-(3-methyl-1,2,4-oxadiazol-5-yl)indole-5-carboxylic acid |
| SMILES | CCCCCCCCc1ccc(OCC(O)Cn2c(C(C)(C)C)c(-c3nc(C)no3)c3cc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C33H43N3O5/c1-6-7-8-9-10-11-12-23-13-16-26(17-14-23)40-21-25(37)20-36-28-18-15-24(32(38)39)19-27(28)29(30(36)33(3,4)5)31-34-22(2)35-41-31/h13-19,25,37H,6-12,20-21H2,1-5H3,(H,38,39) |
| InChIKey | IVLCDTIIGDTWKI-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|