C32H45NO5 — CID 11663639
tert-butyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-5-carboxylate (PubChem CID 11663639) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is tert-butyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-5-carboxylate.
| Compound Name | tert-butyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-5-carboxylate |
|---|---|
| PubChem CID | 11663639 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | tert-butyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-5-carboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OCC(O)Cn2ccc3cc(C(=O)OC(C)(C)C)ccc32)cc1 |
| InChI | InChI=1S/C32H45NO5/c1-5-6-7-8-9-10-11-12-21-36-28-14-16-29(17-15-28)37-24-27(34)23-33-20-19-25-22-26(13-18-30(25)33)31(35)38-32(2,3)4/h13-20,22,27,34H,5-12,21,23-24H2,1-4H3 |
| InChIKey | IMBHWNWINYUTIW-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|