C27H24ClNO4 — CID 46868774
prop-2-enyl 1-[3-[4-(3-chlorophenyl)phenoxy]-2-hydroxypropyl]indole-5-carboxylate (PubChem CID 46868774) has the molecular formula C27H24ClNO4 and a molecular weight of 461.95 g/mol. Its IUPAC name is prop-2-enyl 1-[3-[4-(3-chlorophenyl)phenoxy]-2-hydroxypropyl]indole-5-carboxylate.
| Compound Name | prop-2-enyl 1-[3-[4-(3-chlorophenyl)phenoxy]-2-hydroxypropyl]indole-5-carboxylate |
|---|---|
| PubChem CID | 46868774 |
| Molecular Formula | C27H24ClNO4 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | prop-2-enyl 1-[3-[4-(3-chlorophenyl)phenoxy]-2-hydroxypropyl]indole-5-carboxylate |
| SMILES | C=CCOC(=O)c1ccc2c(ccn2CC(O)COc2ccc(-c3cccc(Cl)c3)cc2)c1 |
| InChI | InChI=1S/C27H24ClNO4/c1-2-14-32-27(31)22-8-11-26-21(15-22)12-13-29(26)17-24(30)18-33-25-9-6-19(7-10-25)20-4-3-5-23(28)16-20/h2-13,15-16,24,30H,1,14,17-18H2 |
| InChIKey | UXMZLHXSVVSSLC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|