C34H47NO7 — CID 11577843
5-O-tert-butyl 3-O-methyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-3,5-dicarboxylate (PubChem CID 11577843) has the molecular formula C34H47NO7 and a molecular weight of 581.75 g/mol. Its IUPAC name is 5-O-tert-butyl 3-O-methyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-3,5-dicarboxylate.
| Compound Name | 5-O-tert-butyl 3-O-methyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11577843 |
| Molecular Formula | C34H47NO7 |
| Molecular Weight | 581.75 g/mol |
| Exact Mass | 581.34 |
| IUPAC Name | 5-O-tert-butyl 3-O-methyl 1-[3-(4-decoxyphenoxy)-2-hydroxypropyl]indole-3,5-dicarboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OCC(O)Cn2cc(C(=O)OC)c3cc(C(=O)OC(C)(C)C)ccc32)cc1 |
| InChI | InChI=1S/C34H47NO7/c1-6-7-8-9-10-11-12-13-20-40-27-15-17-28(18-16-27)41-24-26(36)22-35-23-30(33(38)39-5)29-21-25(14-19-31(29)35)32(37)42-34(2,3)4/h14-19,21,23,26,36H,6-13,20,22,24H2,1-5H3 |
| InChIKey | TYPAIEDEBNOVGY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.75 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|