C26H39NO4 — CID 12992896
tert-butyl 1-[2-hydroxy-3-(4-octylphenoxy)propyl]pyrrole-2-carboxylate (PubChem CID 12992896) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is tert-butyl 1-[2-hydroxy-3-(4-octylphenoxy)propyl]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 1-[2-hydroxy-3-(4-octylphenoxy)propyl]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 12992896 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | tert-butyl 1-[2-hydroxy-3-(4-octylphenoxy)propyl]pyrrole-2-carboxylate |
| SMILES | CCCCCCCCc1ccc(OCC(O)Cn2cccc2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H39NO4/c1-5-6-7-8-9-10-12-21-14-16-23(17-15-21)30-20-22(28)19-27-18-11-13-24(27)25(29)31-26(2,3)4/h11,13-18,22,28H,5-10,12,19-20H2,1-4H3 |
| InChIKey | BBFNQCBYUZLXRW-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|