C30H39NO4 — CID 68841315
3-tert-butyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid (PubChem CID 68841315) has the molecular formula C30H39NO4 and a molecular weight of 477.65 g/mol. Its IUPAC name is 3-tert-butyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid.
| Compound Name | 3-tert-butyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 68841315 |
| Molecular Formula | C30H39NO4 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | 3-tert-butyl-1-[3-(4-octylphenoxy)-2-oxopropyl]indole-6-carboxylic acid |
| SMILES | CCCCCCCCc1ccc(OCC(=O)Cn2cc(C(C)(C)C)c3ccc(C(=O)O)cc32)cc1 |
| InChI | InChI=1S/C30H39NO4/c1-5-6-7-8-9-10-11-22-12-15-25(16-13-22)35-21-24(32)19-31-20-27(30(2,3)4)26-17-14-23(29(33)34)18-28(26)31/h12-18,20H,5-11,19,21H2,1-4H3,(H,33,34) |
| InChIKey | WJAHAFVAJLQWBH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|