C17F30O9 — CID 59509910
trifluoromethyl 3-[2,2-bis[difluoro-[1,1,2,2-tetrafluoro-3-oxo-3-(trifluoromethoxy)propoxy]methyl]-1,1,3,3,3-pentafluoropropoxy]-2,2,3,3-tetrafluoropropanoate (PubChem CID 59509910) has the molecular formula C17F30O9 and a molecular weight of 918.12 g/mol. Its IUPAC name is trifluoromethyl 3-[2,2-bis[difluoro-[1,1,2,2-tetrafluoro-3-oxo-3-(trifluoromethoxy)propoxy]methyl]-1,1,3,3,3-pentafluoropropoxy]-2,2,3,3-tetrafluoropropanoate.
| Compound Name | trifluoromethyl 3-[2,2-bis[difluoro-[1,1,2,2-tetrafluoro-3-oxo-3-(trifluoromethoxy)propoxy]methyl]-1,1,3,3,3-pentafluoropropoxy]-2,2,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 59509910 |
| Molecular Formula | C17F30O9 |
| Molecular Weight | 918.12 g/mol |
| Exact Mass | 917.91 |
| IUPAC Name | trifluoromethyl 3-[2,2-bis[difluoro-[1,1,2,2-tetrafluoro-3-oxo-3-(trifluoromethoxy)propoxy]methyl]-1,1,3,3,3-pentafluoropropoxy]-2,2,3,3-tetrafluoropropanoate |
| SMILES | O=C(OC(F)(F)F)C(F)(F)C(F)(F)OC(F)(F)C(C(F)(F)F)(C(F)(F)OC(F)(F)C(F)(F)C(=O)OC(F)(F)F)C(F)(F)OC(F)(F)C(F)(F)C(=O)OC(F)(F)F |
| InChI | InChI=1S/C17F30O9/c18-4(19,1(48)51-15(39,40)41)9(27,28)54-12(33,34)7(8(24,25)26,13(35,36)55-10(29,30)5(20,21)2(49)52-16(42,43)44)14(37,38)56-11(31,32)6(22,23)3(50)53-17(45,46)47 |
| InChIKey | NHBXRYIXDXOMNK-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.12 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|