C31H45FN4O4SSi — CID 59511837
tert-butyl N-[[5-[[2-amino-1-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate (PubChem CID 59511837) has the molecular formula C31H45FN4O4SSi and a molecular weight of 616.88 g/mol. Its IUPAC name is tert-butyl N-[[5-[[2-amino-1-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-[[2-amino-1-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59511837 |
| Molecular Formula | C31H45FN4O4SSi |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 616.29 |
| IUPAC Name | tert-butyl N-[[5-[[2-amino-1-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate |
| SMILES | COc1cc(O[Si](C(C)C)(C(C)C)C(C)C)c(F)c(C(Nc2ccc(C#N)c(CNC(=O)OC(C)(C)C)c2)C(N)=S)c1 |
| InChI | InChI=1S/C31H45FN4O4SSi/c1-18(2)42(19(3)4,20(5)6)40-26-15-24(38-10)14-25(27(26)32)28(29(34)41)36-23-12-11-21(16-33)22(13-23)17-35-30(37)39-31(7,8)9/h11-15,18-20,28,36H,17H2,1-10H3,(H2,34,41)(H,35,37) |
| InChIKey | FNLQTZSDEUJYKY-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|