C24H29FN4O4Si — CID 59511840
2-trimethylsilylethyl N-[[2-cyano-5-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]phenyl]methyl]carbamate (PubChem CID 59511840) has the molecular formula C24H29FN4O4Si and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[[2-cyano-5-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]phenyl]methyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[[2-cyano-5-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59511840 |
| Molecular Formula | C24H29FN4O4Si |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-trimethylsilylethyl N-[[2-cyano-5-[[cyano-(2-fluoro-3,5-dimethoxyphenyl)methyl]amino]phenyl]methyl]carbamate |
| SMILES | COc1cc(OC)c(F)c(C(C#N)Nc2ccc(C#N)c(CNC(=O)OCC[Si](C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H29FN4O4Si/c1-31-19-11-20(23(25)22(12-19)32-2)21(14-27)29-18-7-6-16(13-26)17(10-18)15-28-24(30)33-8-9-34(3,4)5/h6-7,10-12,21,29H,8-9,15H2,1-5H3,(H,28,30) |
| InChIKey | DAOLFLAKUXKWBC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|