C24H31FN4O4SSi — CID 59511857
2-trimethylsilylethyl N-[[5-[[2-amino-1-(2-fluoro-3,5-dimethoxyphenyl)-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate (PubChem CID 59511857) has the molecular formula C24H31FN4O4SSi and a molecular weight of 518.69 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[[5-[[2-amino-1-(2-fluoro-3,5-dimethoxyphenyl)-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[[5-[[2-amino-1-(2-fluoro-3,5-dimethoxyphenyl)-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59511857 |
| Molecular Formula | C24H31FN4O4SSi |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 2-trimethylsilylethyl N-[[5-[[2-amino-1-(2-fluoro-3,5-dimethoxyphenyl)-2-sulfanylideneethyl]amino]-2-cyanophenyl]methyl]carbamate |
| SMILES | COc1cc(OC)c(F)c(C(Nc2ccc(C#N)c(CNC(=O)OCC[Si](C)(C)C)c2)C(N)=S)c1 |
| InChI | InChI=1S/C24H31FN4O4SSi/c1-31-18-11-19(21(25)20(12-18)32-2)22(23(27)34)29-17-7-6-15(13-26)16(10-17)14-28-24(30)33-8-9-35(3,4)5/h6-7,10-12,22,29H,8-9,14H2,1-5H3,(H2,27,34)(H,28,30) |
| InChIKey | JEZHFONLIXNXHS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|