C16H25N3 — CID 59514046
1-methyl-N,N-bis(2-methylpropyl)indazol-5-amine (PubChem CID 59514046) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-methyl-N,N-bis(2-methylpropyl)indazol-5-amine.
| Compound Name | 1-methyl-N,N-bis(2-methylpropyl)indazol-5-amine |
|---|---|
| PubChem CID | 59514046 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-methyl-N,N-bis(2-methylpropyl)indazol-5-amine |
| SMILES | CC(C)CN(CC(C)C)c1ccc2c(cnn2C)c1 |
| InChI | InChI=1S/C16H25N3/c1-12(2)10-19(11-13(3)4)15-6-7-16-14(8-15)9-17-18(16)5/h6-9,12-13H,10-11H2,1-5H3 |
| InChIKey | INYMANWNFLFLLV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |