C22H19Br2N3 — CID 59514083
N,N-bis[(4-bromophenyl)methyl]-1-methylindazol-5-amine (PubChem CID 59514083) has the molecular formula C22H19Br2N3 and a molecular weight of 485.22 g/mol. Its IUPAC name is N,N-bis[(4-bromophenyl)methyl]-1-methylindazol-5-amine.
| Compound Name | N,N-bis[(4-bromophenyl)methyl]-1-methylindazol-5-amine |
|---|---|
| PubChem CID | 59514083 |
| Molecular Formula | C22H19Br2N3 |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | N,N-bis[(4-bromophenyl)methyl]-1-methylindazol-5-amine |
| SMILES | Cn1ncc2cc(N(Cc3ccc(Br)cc3)Cc3ccc(Br)cc3)ccc21 |
| InChI | InChI=1S/C22H19Br2N3/c1-26-22-11-10-21(12-18(22)13-25-26)27(14-16-2-6-19(23)7-3-16)15-17-4-8-20(24)9-5-17/h2-13H,14-15H2,1H3 |
| InChIKey | LKHJLZPKUSQRAP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |