C10H8F3N4- — CID 59526767
CID 59526767 (PubChem CID 59526767) has the molecular formula C10H8F3N4- and a molecular weight of 241.20 g/mol.
| Compound Name | CID 59526767 |
|---|---|
| PubChem CID | 59526767 |
| Molecular Formula | C10H8F3N4- |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | — |
| SMILES | [CH2-]n1nnc(Cc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C10H8F3N4/c1-17-15-9(14-16-17)6-7-2-4-8(5-3-7)10(11,12)13/h2-5H,1,6H2/q-1 |
| InChIKey | TWRFEOMAGVXOKE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|