C23H34FN2O3 — CID 59530892
CID 59530892 (PubChem CID 59530892) has the molecular formula C23H34FN2O3 and a molecular weight of 405.53 g/mol.
| Compound Name | CID 59530892 |
|---|---|
| PubChem CID | 59530892 |
| Molecular Formula | C23H34FN2O3 |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | — |
| SMILES | CCCCCCCC(=O)N[C@@H]([CH]c1ccc2c(c1)OCCO2)CN1CC[C@H](F)C1 |
| InChI | InChI=1S/C23H34FN2O3/c1-2-3-4-5-6-7-23(27)25-20(17-26-11-10-19(24)16-26)14-18-8-9-21-22(15-18)29-13-12-28-21/h8-9,14-15,19-20H,2-7,10-13,16-17H2,1H3,(H,25,27)/t19-,20-/m0/s1 |
| InChIKey | VWMKHVFJBZCPDK-PMACEKPBSA-N |
| XLogP | 3.90 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|