C23H35N2O4 — CID 59531103
CID 59531103 (PubChem CID 59531103) has the molecular formula C23H35N2O4 and a molecular weight of 403.54 g/mol.
| Compound Name | CID 59531103 |
|---|---|
| PubChem CID | 59531103 |
| Molecular Formula | C23H35N2O4 |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | — |
| SMILES | CCCCCCCC(=O)N[C@@H]([CH]c1ccc2c(c1)OCCO2)CN1CC[C@@H](O)C1 |
| InChI | InChI=1S/C23H35N2O4/c1-2-3-4-5-6-7-23(27)24-19(16-25-11-10-20(26)17-25)14-18-8-9-21-22(15-18)29-13-12-28-21/h8-9,14-15,19-20,26H,2-7,10-13,16-17H2,1H3,(H,24,27)/t19-,20+/m0/s1 |
| InChIKey | XJFZFPWAFUDCGK-VQTJNVASSA-N |
| XLogP | 2.92 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|