C21H20F2N8O6 — CID 59531606
(5R)-3-[3,5-difluoro-4-[1-(5-nitrofuran-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 59531606) has the molecular formula C21H20F2N8O6 and a molecular weight of 518.44 g/mol. Its IUPAC name is (5R)-3-[3,5-difluoro-4-[1-(5-nitrofuran-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3,5-difluoro-4-[1-(5-nitrofuran-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59531606 |
| Molecular Formula | C21H20F2N8O6 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | (5R)-3-[3,5-difluoro-4-[1-(5-nitrofuran-2-carbonyl)-1,2,5-triazepan-5-yl]phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N1CCN(c2c(F)cc(N3C[C@H](Cn4ccnn4)OC3=O)cc2F)CCN1 |
| InChI | InChI=1S/C21H20F2N8O6/c22-15-9-13(29-12-14(36-21(29)33)11-28-6-3-24-26-28)10-16(23)19(15)27-5-4-25-30(8-7-27)20(32)17-1-2-18(37-17)31(34)35/h1-3,6,9-10,14,25H,4-5,7-8,11-12H2/t14-/m0/s1 |
| InChIKey | CKSCTVLLYMJQGL-AWEZNQCLSA-N |
| XLogP | 1.55 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|