C26H29N3O5 — CID 59535507
tert-butyl 3-[(4-methoxycarbonylphenyl)methylcarbamoyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate (PubChem CID 59535507) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is tert-butyl 3-[(4-methoxycarbonylphenyl)methylcarbamoyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate.
| Compound Name | tert-butyl 3-[(4-methoxycarbonylphenyl)methylcarbamoyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 59535507 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | tert-butyl 3-[(4-methoxycarbonylphenyl)methylcarbamoyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraene-10-carboxylate |
| SMILES | COC(=O)c1ccc(CNC(=O)c2cn3c4c(cccc24)CN(C(=O)OC(C)(C)C)CC3)cc1 |
| InChI | InChI=1S/C26H29N3O5/c1-26(2,3)34-25(32)29-13-12-28-16-21(20-7-5-6-19(15-29)22(20)28)23(30)27-14-17-8-10-18(11-9-17)24(31)33-4/h5-11,16H,12-15H2,1-4H3,(H,27,30) |
| InChIKey | GAZVQCZWGRQMGN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |