About cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine
cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine (PubChem CID 59537034) has the molecular formula C18H16CoN4
and a molecular weight of 347.29 g/mol. Its IUPAC name is cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine.
Molecular Properties
| Compound Name | cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine |
| PubChem CID | 59537034 |
| Molecular Formula | C18H16CoN4 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine |
| SMILES | C/C(=N\c1ccccc1/N=C(\C)c1ccc[n-]1)c1ccc[n-]1.[Co+2] |
| InChI | InChI=1S/C18H16N4.Co/c1-13(15-9-5-11-19-15)21-17-7-3-4-8-18(17)22-14(2)16-10-6-12-20-16;/h3-12H,1-2H3;/q-2;+2/b21-13+,22-14+; |
| InChIKey | MXQKPWMJIBTXCL-JKBLJYNNSA-N |
| XLogP | 3.88 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine?
The IUPAC name of cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine (CID 59537034) is cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine.
What is the SMILES notation for cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine?
The canonical SMILES for cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine is C/C(=N\c1ccccc1/N=C(\C)c1ccc[n-]1)c1ccc[n-]1.[Co+2].
What is the InChIKey of cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine?
The InChIKey is MXQKPWMJIBTXCL-JKBLJYNNSA-N. The full InChI is InChI=1S/C18H16N4.Co/c1-13(15-9-5-11-19-15)21-17-7-3-4-8-18(17)22-14(2)16-10-6-12-20-16;/h3-12H,1-2H3;/q-2;+2/b21-13+,22-14+;.
What are the key properties of cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine?
cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine has a molecular weight of 347.29 g/mol, XLogP of 3.88, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);1-pyrrol-1-id-2-yl-N-[2-(1-pyrrol-1-id-2-ylethylideneamino)phenyl]ethanimine is sourced from PubChem (CID 59537034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).