C42H31N3O2 — CID 59538396
5-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]-2-(1,3-dioxolan-2-yl)pyridine (PubChem CID 59538396) has the molecular formula C42H31N3O2 and a molecular weight of 609.73 g/mol. Its IUPAC name is 5-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]-2-(1,3-dioxolan-2-yl)pyridine.
| Compound Name | 5-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]-2-(1,3-dioxolan-2-yl)pyridine |
|---|---|
| PubChem CID | 59538396 |
| Molecular Formula | C42H31N3O2 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 5-[3-[3,5-bis(3-pyridin-3-ylphenyl)phenyl]phenyl]-2-(1,3-dioxolan-2-yl)pyridine |
| SMILES | c1cncc(-c2cccc(-c3cc(-c4cccc(-c5cccnc5)c4)cc(-c4cccc(-c5ccc(C6OCCO6)nc5)c4)c3)c2)c1 |
| InChI | InChI=1S/C42H31N3O2/c1-6-29(35-12-4-16-43-26-35)20-32(9-1)38-23-39(33-10-2-7-30(21-33)36-13-5-17-44-27-36)25-40(24-38)34-11-3-8-31(22-34)37-14-15-41(45-28-37)42-46-18-19-47-42/h1-17,20-28,42H,18-19H2 |
| InChIKey | NTUDZDLBKVFTAV-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |