About (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one
(3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one (PubChem CID 59546442) has the molecular formula C15H25NO3
and a molecular weight of 267.37 g/mol. Its IUPAC name is (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one |
| PubChem CID | 59546442 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)[C@@H]1C[C@@H](C2C[C@@H](C(C)C)C(=O)N2C)OC1=O |
| InChI | InChI=1S/C15H25NO3/c1-8(2)10-6-12(16(5)14(10)17)13-7-11(9(3)4)15(18)19-13/h8-13H,6-7H2,1-5H3/t10-,11-,12?,13-/m0/s1 |
| InChIKey | OKKNOJXTMFTEFY-XYIZDEMUSA-N |
| XLogP | 2.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one?
The IUPAC name of (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one (CID 59546442) is (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one.
What is the SMILES notation for (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one?
The canonical SMILES for (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one is CC(C)[C@@H]1C[C@@H](C2C[C@@H](C(C)C)C(=O)N2C)OC1=O.
What is the InChIKey of (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one?
The InChIKey is OKKNOJXTMFTEFY-XYIZDEMUSA-N. The full InChI is InChI=1S/C15H25NO3/c1-8(2)10-6-12(16(5)14(10)17)13-7-11(9(3)4)15(18)19-13/h8-13H,6-7H2,1-5H3/t10-,11-,12?,13-/m0/s1.
What are the key properties of (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one?
(3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one has a molecular weight of 267.37 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-methyl-5-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-3-propan-2-ylpyrrolidin-2-one is sourced from PubChem (CID 59546442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).