C17H17ClN8O2S — CID 59548471
N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]cyclopropanesulfonamide (PubChem CID 59548471) has the molecular formula C17H17ClN8O2S and a molecular weight of 432.90 g/mol. Its IUPAC name is N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]cyclopropanesulfonamide.
| Compound Name | N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 59548471 |
| Molecular Formula | C17H17ClN8O2S |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N-[5-[[3-(4-amino-6-methyl-1,3,5-triazin-2-yl)-2-pyridinyl]amino]-2-chloro-3-pyridinyl]cyclopropanesulfonamide |
| SMILES | Cc1nc(N)nc(-c2cccnc2Nc2cnc(Cl)c(NS(=O)(=O)C3CC3)c2)n1 |
| InChI | InChI=1S/C17H17ClN8O2S/c1-9-22-16(25-17(19)23-9)12-3-2-6-20-15(12)24-10-7-13(14(18)21-8-10)26-29(27,28)11-4-5-11/h2-3,6-8,11,26H,4-5H2,1H3,(H,20,24)(H2,19,22,23,25) |
| InChIKey | FOVDAQSOCPEZCB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|