C24H22Cl2N4O5S2 — CID 59549103
4-[2-(2,5-dichlorophenyl)sulfanyl-5-nitrophenyl]sulfonyl-N-(4-methylphenyl)piperazine-1-carboxamide (PubChem CID 59549103) has the molecular formula C24H22Cl2N4O5S2 and a molecular weight of 581.50 g/mol. Its IUPAC name is 4-[2-(2,5-dichlorophenyl)sulfanyl-5-nitrophenyl]sulfonyl-N-(4-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(2,5-dichlorophenyl)sulfanyl-5-nitrophenyl]sulfonyl-N-(4-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 59549103 |
| Molecular Formula | C24H22Cl2N4O5S2 |
| Molecular Weight | 581.50 g/mol |
| Exact Mass | 580.04 |
| IUPAC Name | 4-[2-(2,5-dichlorophenyl)sulfanyl-5-nitrophenyl]sulfonyl-N-(4-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCN(S(=O)(=O)c3cc([N+](=O)[O-])ccc3Sc3cc(Cl)ccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C24H22Cl2N4O5S2/c1-16-2-5-18(6-3-16)27-24(31)28-10-12-29(13-11-28)37(34,35)23-15-19(30(32)33)7-9-21(23)36-22-14-17(25)4-8-20(22)26/h2-9,14-15H,10-13H2,1H3,(H,27,31) |
| InChIKey | GGIPCZJZKGJLQX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|