methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate

C14H21O6P — CID 59560466

IUPACmethyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate
SMILESCCOC(COc1cc(OP)cc(C(=O)OC)c1)OCC
InChIInChI=1S/C14H21O6P/c1-4-17-13(18-5-2)9-19-11-6-10(14(15)16-3)7-12(8-11)20-21/h6-8,13H,4-5,9,21H2,1-3H3
InChIKeyPXAPQAALAKCDPD-UHFFFAOYSA-N
MW316.29 g/mol
LogP2.42
Rot. Bonds9

About methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate

methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate (PubChem CID 59560466) has the molecular formula C14H21O6P and a molecular weight of 316.29 g/mol. Its IUPAC name is methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate.

Molecular Properties

Compound Namemethyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate
PubChem CID59560466
Molecular FormulaC14H21O6P
Molecular Weight316.29 g/mol
Exact Mass316.11
IUPAC Namemethyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate
SMILESCCOC(COc1cc(OP)cc(C(=O)OC)c1)OCC
InChIInChI=1S/C14H21O6P/c1-4-17-13(18-5-2)9-19-11-6-10(14(15)16-3)7-12(8-11)20-21/h6-8,13H,4-5,9,21H2,1-3H3
InChIKeyPXAPQAALAKCDPD-UHFFFAOYSA-N
XLogP2.42
TPSA63.22 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.29
LogP ≤ 52.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate?
The IUPAC name of methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate (CID 59560466) is methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate.
What is the SMILES notation for methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate?
The canonical SMILES for methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate is CCOC(COc1cc(OP)cc(C(=O)OC)c1)OCC.
What is the InChIKey of methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate?
The InChIKey is PXAPQAALAKCDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21O6P/c1-4-17-13(18-5-2)9-19-11-6-10(14(15)16-3)7-12(8-11)20-21/h6-8,13H,4-5,9,21H2,1-3H3.
What are the key properties of methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate?
methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate has a molecular weight of 316.29 g/mol, XLogP of 2.42, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate is sourced from PubChem (CID 59560466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).