C14H21O6P — CID 59560466
methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate (PubChem CID 59560466) has the molecular formula C14H21O6P and a molecular weight of 316.29 g/mol. Its IUPAC name is methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate.
| Compound Name | methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate |
|---|---|
| PubChem CID | 59560466 |
| Molecular Formula | C14H21O6P |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | methyl 3-(2,2-diethoxyethoxy)-5-phosphanyloxybenzoate |
| SMILES | CCOC(COc1cc(OP)cc(C(=O)OC)c1)OCC |
| InChI | InChI=1S/C14H21O6P/c1-4-17-13(18-5-2)9-19-11-6-10(14(15)16-3)7-12(8-11)20-21/h6-8,13H,4-5,9,21H2,1-3H3 |
| InChIKey | PXAPQAALAKCDPD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|