C21H26N6O3 — CID 59561390
2-[6-amino-4-imino-3-[2-(2-pyrrolidin-1-ylethoxy)pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol (PubChem CID 59561390) has the molecular formula C21H26N6O3 and a molecular weight of 410.48 g/mol. Its IUPAC name is 2-[6-amino-4-imino-3-[2-(2-pyrrolidin-1-ylethoxy)pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol.
| Compound Name | 2-[6-amino-4-imino-3-[2-(2-pyrrolidin-1-ylethoxy)pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 59561390 |
| Molecular Formula | C21H26N6O3 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[6-amino-4-imino-3-[2-(2-pyrrolidin-1-ylethoxy)pyrazolo[1,5-a]pyridin-3-yl]iminocyclohexa-1,5-dien-1-yl]oxyethanol |
| SMILES | [H]/N=C1\C=C(N)C(OCCO)=C\C1=N/c1c(OCCN2CCCC2)nn2ccccc12 |
| InChI | InChI=1S/C21H26N6O3/c22-15-13-16(23)19(29-12-10-28)14-17(15)24-20-18-5-1-2-8-27(18)25-21(20)30-11-9-26-6-3-4-7-26/h1-2,5,8,13-14,22,28H,3-4,6-7,9-12,23H2/b22-15+,24-17+ |
| InChIKey | CYLQWDVVXMINOB-IJSVXNFFSA-N |
| XLogP | 1.65 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|