C13H17BrFNO2S — CID 59563475
1-(4-bromo-3-fluorophenoxy)-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 59563475) has the molecular formula C13H17BrFNO2S and a molecular weight of 350.25 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenoxy)-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | 1-(4-bromo-3-fluorophenoxy)-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 59563475 |
| Molecular Formula | C13H17BrFNO2S |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1-(4-bromo-3-fluorophenoxy)-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | OC(COc1ccc(Br)c(F)c1)CN1CCSCC1 |
| InChI | InChI=1S/C13H17BrFNO2S/c14-12-2-1-11(7-13(12)15)18-9-10(17)8-16-3-5-19-6-4-16/h1-2,7,10,17H,3-6,8-9H2 |
| InChIKey | RYTGSIJFFZGKBH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |